C15H24NO+ — CID 58810692
[2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium (PubChem CID 58810692) has the molecular formula C15H24NO+ and a molecular weight of 234.36 g/mol. Its IUPAC name is [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium.
| Compound Name | [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 58810692 |
| Molecular Formula | C15H24NO+ |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | [2-(3-hydroxyphenyl)cyclohexyl]methyl-dimethylazanium |
| SMILES | C[NH+](C)CC1CCCCC1c1cccc(O)c1 |
| InChI | InChI=1S/C15H23NO/c1-16(2)11-13-6-3-4-9-15(13)12-7-5-8-14(17)10-12/h5,7-8,10,13,15,17H,3-4,6,9,11H2,1-2H3/p+1 |
| InChIKey | JIRYWFYYBBRJAN-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |