About [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol
[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol (PubChem CID 18653697) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol |
| PubChem CID | 18653697 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol |
| SMILES | CCCCN1CC[C@H](c2ccc(N(C)C)cc2)[C@@H](CO)C1 |
| InChI | InChI=1S/C18H30N2O/c1-4-5-11-20-12-10-18(16(13-20)14-21)15-6-8-17(9-7-15)19(2)3/h6-9,16,18,21H,4-5,10-14H2,1-3H3/t16-,18-/m1/s1 |
| InChIKey | CQTOATVNXKJCTD-SJLPKXTDSA-N |
| XLogP | 2.95 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol (CID 18653697) is [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol is CCCCN1CC[C@H](c2ccc(N(C)C)cc2)[C@@H](CO)C1.
What is the InChIKey of [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol?
The InChIKey is CQTOATVNXKJCTD-SJLPKXTDSA-N. The full InChI is InChI=1S/C18H30N2O/c1-4-5-11-20-12-10-18(16(13-20)14-21)15-6-8-17(9-7-15)19(2)3/h6-9,16,18,21H,4-5,10-14H2,1-3H3/t16-,18-/m1/s1.
What are the key properties of [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol?
[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol has a molecular weight of 290.45 g/mol, XLogP of 2.95, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methanol is sourced from PubChem (CID 18653697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).