C26H35F3N2O — CID 70083965
N,N-dimethyl-4-[(3S,4R)-1-pentyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline (PubChem CID 70083965) has the molecular formula C26H35F3N2O and a molecular weight of 448.57 g/mol. Its IUPAC name is N,N-dimethyl-4-[(3S,4R)-1-pentyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(3S,4R)-1-pentyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline |
|---|---|
| PubChem CID | 70083965 |
| Molecular Formula | C26H35F3N2O |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N,N-dimethyl-4-[(3S,4R)-1-pentyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline |
| SMILES | CCCCCN1CC[C@@H](c2ccc(N(C)C)cc2)[C@H](COc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C26H35F3N2O/c1-4-5-6-16-31-17-15-25(20-7-11-23(12-8-20)30(2)3)21(18-31)19-32-24-13-9-22(10-14-24)26(27,28)29/h7-14,21,25H,4-6,15-19H2,1-3H3/t21-,25-/m0/s1 |
| InChIKey | IUIPOHMZXOJECG-OFVILXPXSA-N |
| XLogP | 6.45 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|