C28H40ClF3N2O — CID 131718552
N,N-diethyl-4-[(3S,4R)-1-(2-methylbutyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride (PubChem CID 131718552) has the molecular formula C28H40ClF3N2O and a molecular weight of 513.09 g/mol. Its IUPAC name is N,N-diethyl-4-[(3S,4R)-1-(2-methylbutyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride.
| Compound Name | N,N-diethyl-4-[(3S,4R)-1-(2-methylbutyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride |
|---|---|
| PubChem CID | 131718552 |
| Molecular Formula | C28H40ClF3N2O |
| Molecular Weight | 513.09 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N,N-diethyl-4-[(3S,4R)-1-(2-methylbutyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride |
| SMILES | CCC(C)CN1CC[C@@H](c2ccc(N(CC)CC)cc2)[C@H](COc2ccc(C(F)(F)F)cc2)C1.Cl |
| InChI | InChI=1S/C28H39F3N2O.ClH/c1-5-21(4)18-32-17-16-27(22-8-12-25(13-9-22)33(6-2)7-3)23(19-32)20-34-26-14-10-24(11-15-26)28(29,30)31;/h8-15,21,23,27H,5-7,16-20H2,1-4H3;1H/t21?,23-,27-;/m0./s1 |
| InChIKey | WMKQCZXPIAXKTB-RFLGHODPSA-N |
| XLogP | 7.50 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.09 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|