C28H40N2O — CID 23197578
4-[1-butyl-3-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperidin-4-yl]-N,N-dimethylaniline (PubChem CID 23197578) has the molecular formula C28H40N2O and a molecular weight of 420.64 g/mol. Its IUPAC name is 4-[1-butyl-3-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperidin-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-butyl-3-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperidin-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23197578 |
| Molecular Formula | C28H40N2O |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | 4-[1-butyl-3-(5,6,7,8-tetrahydronaphthalen-2-yloxymethyl)piperidin-4-yl]-N,N-dimethylaniline |
| SMILES | CCCCN1CCC(c2ccc(N(C)C)cc2)C(COc2ccc3c(c2)CCCC3)C1 |
| InChI | InChI=1S/C28H40N2O/c1-4-5-17-30-18-16-28(23-10-13-26(14-11-23)29(2)3)25(20-30)21-31-27-15-12-22-8-6-7-9-24(22)19-27/h10-15,19,25,28H,4-9,16-18,20-21H2,1-3H3 |
| InChIKey | SWOKKXTYJPFBKW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|