C23H30ClF3N2O — CID 67673628
4-[(3R,4S)-1-butyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride (PubChem CID 67673628) has the molecular formula C23H30ClF3N2O and a molecular weight of 442.95 g/mol. Its IUPAC name is 4-[(3R,4S)-1-butyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride.
| Compound Name | 4-[(3R,4S)-1-butyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride |
|---|---|
| PubChem CID | 67673628 |
| Molecular Formula | C23H30ClF3N2O |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 4-[(3R,4S)-1-butyl-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]aniline;hydrochloride |
| SMILES | CCCCN1CC[C@H](c2ccc(N)cc2)[C@@H](COc2ccc(C(F)(F)F)cc2)C1.Cl |
| InChI | InChI=1S/C23H29F3N2O.ClH/c1-2-3-13-28-14-12-22(17-4-8-20(27)9-5-17)18(15-28)16-29-21-10-6-19(7-11-21)23(24,25)26;/h4-11,18,22H,2-3,12-16,27H2,1H3;1H/t18-,22-;/m1./s1 |
| InChIKey | ODLOIPKLNGCPCY-TVNLMDKXSA-N |
| XLogP | 5.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|