C25H31F3N2O — CID 19014406
4-[1-(cyclopropylmethyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]-N,N-dimethylaniline (PubChem CID 19014406) has the molecular formula C25H31F3N2O and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-[1-(cyclopropylmethyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-(cyclopropylmethyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 19014406 |
| Molecular Formula | C25H31F3N2O |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 4-[1-(cyclopropylmethyl)-3-[[4-(trifluoromethyl)phenoxy]methyl]piperidin-4-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2CCN(CC3CC3)CC2COc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C25H31F3N2O/c1-29(2)22-9-5-19(6-10-22)24-13-14-30(15-18-3-4-18)16-20(24)17-31-23-11-7-21(8-12-23)25(26,27)28/h5-12,18,20,24H,3-4,13-17H2,1-2H3 |
| InChIKey | UHXHTKHXLGEDFJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|