C22H28F3NOS — CID 19900569
1-pentyl-4-thiophen-3-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine (PubChem CID 19900569) has the molecular formula C22H28F3NOS and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-pentyl-4-thiophen-3-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine.
| Compound Name | 1-pentyl-4-thiophen-3-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 19900569 |
| Molecular Formula | C22H28F3NOS |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-pentyl-4-thiophen-3-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine |
| SMILES | CCCCCN1CCC(c2ccsc2)C(COc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C22H28F3NOS/c1-2-3-4-10-26-11-8-21(17-9-12-28-16-17)18(14-26)15-27-20-7-5-6-19(13-20)22(23,24)25/h5-7,9,12-13,16,18,21H,2-4,8,10-11,14-15H2,1H3 |
| InChIKey | GEJCSTCMOOEDNB-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|