C22H31NO2S — CID 19900546
3-[(3-methoxyphenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine (PubChem CID 19900546) has the molecular formula C22H31NO2S and a molecular weight of 373.56 g/mol. Its IUPAC name is 3-[(3-methoxyphenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine.
| Compound Name | 3-[(3-methoxyphenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine |
|---|---|
| PubChem CID | 19900546 |
| Molecular Formula | C22H31NO2S |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 3-[(3-methoxyphenoxy)methyl]-1-pentyl-4-thiophen-3-ylpiperidine |
| SMILES | CCCCCN1CCC(c2ccsc2)C(COc2cccc(OC)c2)C1 |
| InChI | InChI=1S/C22H31NO2S/c1-3-4-5-11-23-12-9-22(18-10-13-26-17-18)19(15-23)16-25-21-8-6-7-20(14-21)24-2/h6-8,10,13-14,17,19,22H,3-5,9,11-12,15-16H2,1-2H3 |
| InChIKey | NZWPZULIKDZNGT-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|