C22H35NO7 — CID 158967842
(3S,4R)-3-methoxy-4-[2-(3-methoxyphenoxy)ethyl]-1-pentylpiperidine;oxalic acid (PubChem CID 158967842) has the molecular formula C22H35NO7 and a molecular weight of 425.52 g/mol. Its IUPAC name is (3S,4R)-3-methoxy-4-[2-(3-methoxyphenoxy)ethyl]-1-pentylpiperidine;oxalic acid.
| Compound Name | (3S,4R)-3-methoxy-4-[2-(3-methoxyphenoxy)ethyl]-1-pentylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 158967842 |
| Molecular Formula | C22H35NO7 |
| Molecular Weight | 425.52 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (3S,4R)-3-methoxy-4-[2-(3-methoxyphenoxy)ethyl]-1-pentylpiperidine;oxalic acid |
| SMILES | CCCCCN1CC[C@H](CCOc2cccc(OC)c2)[C@H](OC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H33NO3.C2H2O4/c1-4-5-6-12-21-13-10-17(20(16-21)23-3)11-14-24-19-9-7-8-18(15-19)22-2;3-1(4)2(5)6/h7-9,15,17,20H,4-6,10-14,16H2,1-3H3;(H,3,4)(H,5,6)/t17-,20-;/m1./s1 |
| InChIKey | CRFMHXWWNRSCLT-OGPPPPIKSA-N |
| XLogP | 3.15 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|