C22H37NO3 — CID 18394750
(3R,4R)-3-methoxy-1-pentyl-4-[2-(3-propan-2-yloxyphenoxy)ethyl]piperidine (PubChem CID 18394750) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-1-pentyl-4-[2-(3-propan-2-yloxyphenoxy)ethyl]piperidine.
| Compound Name | (3R,4R)-3-methoxy-1-pentyl-4-[2-(3-propan-2-yloxyphenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 18394750 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | (3R,4R)-3-methoxy-1-pentyl-4-[2-(3-propan-2-yloxyphenoxy)ethyl]piperidine |
| SMILES | CCCCCN1CC[C@H](CCOc2cccc(OC(C)C)c2)[C@@H](OC)C1 |
| InChI | InChI=1S/C22H37NO3/c1-5-6-7-13-23-14-11-19(22(17-23)24-4)12-15-25-20-9-8-10-21(16-20)26-18(2)3/h8-10,16,18-19,22H,5-7,11-15,17H2,1-4H3/t19-,22+/m1/s1 |
| InChIKey | QERKQJZJXDUXJK-KNQAVFIVSA-N |
| XLogP | 4.77 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|