C19H30ClNO2 — CID 18394749
(3R,4R)-4-[2-(3-chlorophenoxy)ethyl]-3-methoxy-1-pentylpiperidine (PubChem CID 18394749) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is (3R,4R)-4-[2-(3-chlorophenoxy)ethyl]-3-methoxy-1-pentylpiperidine.
| Compound Name | (3R,4R)-4-[2-(3-chlorophenoxy)ethyl]-3-methoxy-1-pentylpiperidine |
|---|---|
| PubChem CID | 18394749 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (3R,4R)-4-[2-(3-chlorophenoxy)ethyl]-3-methoxy-1-pentylpiperidine |
| SMILES | CCCCCN1CC[C@H](CCOc2cccc(Cl)c2)[C@@H](OC)C1 |
| InChI | InChI=1S/C19H30ClNO2/c1-3-4-5-11-21-12-9-16(19(15-21)22-2)10-13-23-18-8-6-7-17(20)14-18/h6-8,14,16,19H,3-5,9-13,15H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | MFVMXNJVTMCZKS-APWZRJJASA-N |
| XLogP | 4.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|