C18H27Cl2NO — CID 54424720
4-[2-(3,5-dichlorophenoxy)ethyl]-1-pentylpiperidine (PubChem CID 54424720) has the molecular formula C18H27Cl2NO and a molecular weight of 344.33 g/mol. Its IUPAC name is 4-[2-(3,5-dichlorophenoxy)ethyl]-1-pentylpiperidine.
| Compound Name | 4-[2-(3,5-dichlorophenoxy)ethyl]-1-pentylpiperidine |
|---|---|
| PubChem CID | 54424720 |
| Molecular Formula | C18H27Cl2NO |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[2-(3,5-dichlorophenoxy)ethyl]-1-pentylpiperidine |
| SMILES | CCCCCN1CCC(CCOc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H27Cl2NO/c1-2-3-4-8-21-9-5-15(6-10-21)7-11-22-18-13-16(19)12-17(20)14-18/h12-15H,2-11H2,1H3 |
| InChIKey | WDGYAWZCBZVONC-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|