C23H39NO — CID 167068129
4-[2-[4-(2,2-dimethylpropyl)phenoxy]ethyl]-1-pentylpiperidine (PubChem CID 167068129) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is 4-[2-[4-(2,2-dimethylpropyl)phenoxy]ethyl]-1-pentylpiperidine.
| Compound Name | 4-[2-[4-(2,2-dimethylpropyl)phenoxy]ethyl]-1-pentylpiperidine |
|---|---|
| PubChem CID | 167068129 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | 4-[2-[4-(2,2-dimethylpropyl)phenoxy]ethyl]-1-pentylpiperidine |
| SMILES | CCCCCN1CCC(CCOc2ccc(CC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H39NO/c1-5-6-7-15-24-16-12-20(13-17-24)14-18-25-22-10-8-21(9-11-22)19-23(2,3)4/h8-11,20H,5-7,12-19H2,1-4H3 |
| InChIKey | QUQZRKPPAJMZFL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|