C21H35NO — CID 146312573
4-[2-(4-ethylphenoxy)ethyl]-1-(4-methylpentyl)piperidine (PubChem CID 146312573) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is 4-[2-(4-ethylphenoxy)ethyl]-1-(4-methylpentyl)piperidine.
| Compound Name | 4-[2-(4-ethylphenoxy)ethyl]-1-(4-methylpentyl)piperidine |
|---|---|
| PubChem CID | 146312573 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 4-[2-(4-ethylphenoxy)ethyl]-1-(4-methylpentyl)piperidine |
| SMILES | CCc1ccc(OCCC2CCN(CCCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H35NO/c1-4-19-7-9-21(10-8-19)23-17-13-20-11-15-22(16-12-20)14-5-6-18(2)3/h7-10,18,20H,4-6,11-17H2,1-3H3 |
| InChIKey | TXHVTUGMIWMSFJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |