C25H37Cl2NO6 — CID 160866816
(3S,4S)-4-[2-(3,4-dichlorophenoxy)ethyl]-3-(3-methylbut-2-enoxy)-1-pentylpiperidine;oxalic acid (PubChem CID 160866816) has the molecular formula C25H37Cl2NO6 and a molecular weight of 518.48 g/mol. Its IUPAC name is (3S,4S)-4-[2-(3,4-dichlorophenoxy)ethyl]-3-(3-methylbut-2-enoxy)-1-pentylpiperidine;oxalic acid.
| Compound Name | (3S,4S)-4-[2-(3,4-dichlorophenoxy)ethyl]-3-(3-methylbut-2-enoxy)-1-pentylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 160866816 |
| Molecular Formula | C25H37Cl2NO6 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (3S,4S)-4-[2-(3,4-dichlorophenoxy)ethyl]-3-(3-methylbut-2-enoxy)-1-pentylpiperidine;oxalic acid |
| SMILES | CCCCCN1CC[C@@H](CCOc2ccc(Cl)c(Cl)c2)[C@H](OCC=C(C)C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H35Cl2NO2.C2H2O4/c1-4-5-6-12-26-13-9-19(23(17-26)28-14-10-18(2)3)11-15-27-20-7-8-21(24)22(25)16-20;3-1(4)2(5)6/h7-8,10,16,19,23H,4-6,9,11-15,17H2,1-3H3;(H,3,4)(H,5,6)/t19-,23+;/m0./s1 |
| InChIKey | FUJPQAHVLJFCSM-ADMBKAPUSA-N |
| XLogP | 5.78 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|