C19H30N2O4 — CID 18394732
(3R,4S)-3-methoxy-4-[2-(4-nitrophenoxy)ethyl]-1-pentylpiperidine (PubChem CID 18394732) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is (3R,4S)-3-methoxy-4-[2-(4-nitrophenoxy)ethyl]-1-pentylpiperidine.
| Compound Name | (3R,4S)-3-methoxy-4-[2-(4-nitrophenoxy)ethyl]-1-pentylpiperidine |
|---|---|
| PubChem CID | 18394732 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (3R,4S)-3-methoxy-4-[2-(4-nitrophenoxy)ethyl]-1-pentylpiperidine |
| SMILES | CCCCCN1CC[C@@H](CCOc2ccc([N+](=O)[O-])cc2)[C@@H](OC)C1 |
| InChI | InChI=1S/C19H30N2O4/c1-3-4-5-12-20-13-10-16(19(15-20)24-2)11-14-25-18-8-6-17(7-9-18)21(22)23/h6-9,16,19H,3-5,10-15H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | ZQBCUHAEUWMMII-LPHOPBHVSA-N |
| XLogP | 3.89 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|