C21H28N2O8 — CID 139782175
6-methoxy-7-[2-(4-nitrophenoxy)ethyl]-10-pentyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione (PubChem CID 139782175) has the molecular formula C21H28N2O8 and a molecular weight of 436.46 g/mol. Its IUPAC name is 6-methoxy-7-[2-(4-nitrophenoxy)ethyl]-10-pentyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione.
| Compound Name | 6-methoxy-7-[2-(4-nitrophenoxy)ethyl]-10-pentyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione |
|---|---|
| PubChem CID | 139782175 |
| Molecular Formula | C21H28N2O8 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 6-methoxy-7-[2-(4-nitrophenoxy)ethyl]-10-pentyl-1,4-dioxa-10-azaspiro[4.5]decane-2,3-dione |
| SMILES | CCCCCN1CCC(CCOc2ccc([N+](=O)[O-])cc2)C(OC)C12OC(=O)C(=O)O2 |
| InChI | InChI=1S/C21H28N2O8/c1-3-4-5-12-22-13-10-15(18(28-2)21(22)30-19(24)20(25)31-21)11-14-29-17-8-6-16(7-9-17)23(26)27/h6-9,15,18H,3-5,10-14H2,1-2H3 |
| InChIKey | PUVYOZUIPWFQIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|