C16H25N3O3 — CID 122133037
1-ethyl-2,5-dimethyl-4-[2-(4-nitrophenoxy)ethyl]piperazine (PubChem CID 122133037) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-ethyl-2,5-dimethyl-4-[2-(4-nitrophenoxy)ethyl]piperazine.
| Compound Name | 1-ethyl-2,5-dimethyl-4-[2-(4-nitrophenoxy)ethyl]piperazine |
|---|---|
| PubChem CID | 122133037 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-ethyl-2,5-dimethyl-4-[2-(4-nitrophenoxy)ethyl]piperazine |
| SMILES | CCN1CC(C)N(CCOc2ccc([N+](=O)[O-])cc2)CC1C |
| InChI | InChI=1S/C16H25N3O3/c1-4-17-11-14(3)18(12-13(17)2)9-10-22-16-7-5-15(6-8-16)19(20)21/h5-8,13-14H,4,9-12H2,1-3H3 |
| InChIKey | YTHOIIPGBNTNIS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|