C14H16ClF3N2O5 — CID 120954344
(3S,4S)-1-[2-(4-nitrophenoxy)ethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 120954344) has the molecular formula C14H16ClF3N2O5 and a molecular weight of 384.74 g/mol. Its IUPAC name is (3S,4S)-1-[2-(4-nitrophenoxy)ethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | (3S,4S)-1-[2-(4-nitrophenoxy)ethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120954344 |
| Molecular Formula | C14H16ClF3N2O5 |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (3S,4S)-1-[2-(4-nitrophenoxy)ethyl]-4-(trifluoromethyl)pyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@H]1CN(CCOc2ccc([N+](=O)[O-])cc2)C[C@H]1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O5.ClH/c15-14(16,17)12-8-18(7-11(12)13(20)21)5-6-24-10-3-1-9(2-4-10)19(22)23;/h1-4,11-12H,5-8H2,(H,20,21);1H/t11-,12-;/m1./s1 |
| InChIKey | MLKYFJOOMWPELQ-MNMPKAIFSA-N |
| XLogP | 2.59 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|