C22H22N2O5 — CID 129051471
(4aR,7aS)-6-[2-[4-[2-(4-nitrophenyl)ethynyl]phenoxy]ethyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole (PubChem CID 129051471) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (4aR,7aS)-6-[2-[4-[2-(4-nitrophenyl)ethynyl]phenoxy]ethyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole.
| Compound Name | (4aR,7aS)-6-[2-[4-[2-(4-nitrophenyl)ethynyl]phenoxy]ethyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 129051471 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (4aR,7aS)-6-[2-[4-[2-(4-nitrophenyl)ethynyl]phenoxy]ethyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
| SMILES | O=[N+]([O-])c1ccc(C#Cc2ccc(OCCN3C[C@@H]4OCCO[C@@H]4C3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O5/c25-24(26)19-7-3-17(4-8-19)1-2-18-5-9-20(10-6-18)27-12-11-23-15-21-22(16-23)29-14-13-28-21/h3-10,21-22H,11-16H2/t21-,22+ |
| InChIKey | DVNZXPZQSAVUJZ-SZPZYZBQSA-N |
| XLogP | 2.47 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|