C16H21ClN2O5 — CID 120680654
(3aS,6aR)-2-[2-(4-nitrophenoxy)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680654) has the molecular formula C16H21ClN2O5 and a molecular weight of 356.81 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-(4-nitrophenoxy)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-(4-nitrophenoxy)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680654 |
| Molecular Formula | C16H21ClN2O5 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (3aS,6aR)-2-[2-(4-nitrophenoxy)ethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)[C@@]12CCC[C@H]1CN(CCOc1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C16H20N2O5.ClH/c19-15(20)16-7-1-2-12(16)10-17(11-16)8-9-23-14-5-3-13(4-6-14)18(21)22;/h3-6,12H,1-2,7-11H2,(H,19,20);1H/t12-,16+;/m0./s1 |
| InChIKey | PWOBGGXIZRQYSE-CVHDTDHSSA-N |
| XLogP | 2.58 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|