C17H25N3O7 — CID 2961425
1-ethyl-4-[3-(4-nitrophenoxy)propyl]piperazine;oxalic acid (PubChem CID 2961425) has the molecular formula C17H25N3O7 and a molecular weight of 383.40 g/mol. Its IUPAC name is 1-ethyl-4-[3-(4-nitrophenoxy)propyl]piperazine;oxalic acid.
| Compound Name | 1-ethyl-4-[3-(4-nitrophenoxy)propyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2961425 |
| Molecular Formula | C17H25N3O7 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 1-ethyl-4-[3-(4-nitrophenoxy)propyl]piperazine;oxalic acid |
| SMILES | CCN1CCN(CCCOc2ccc([N+](=O)[O-])cc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H23N3O3.C2H2O4/c1-2-16-9-11-17(12-10-16)8-3-13-21-15-6-4-14(5-7-15)18(19)20;3-1(4)2(5)6/h4-7H,2-3,8-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | CJPGNDJUJVJZRI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|