C30H41NO6 — CID 67647141
(3R,4S)-1-hexyl-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4-phenylpiperidine;oxalic acid (PubChem CID 67647141) has the molecular formula C30H41NO6 and a molecular weight of 511.66 g/mol. Its IUPAC name is (3R,4S)-1-hexyl-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4-phenylpiperidine;oxalic acid.
| Compound Name | (3R,4S)-1-hexyl-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4-phenylpiperidine;oxalic acid |
|---|---|
| PubChem CID | 67647141 |
| Molecular Formula | C30H41NO6 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.29 |
| IUPAC Name | (3R,4S)-1-hexyl-3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-4-phenylpiperidine;oxalic acid |
| SMILES | C=CCc1ccc(OC[C@H]2CN(CCCCCC)CC[C@@H]2c2ccccc2)c(OC)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C28H39NO2.C2H2O4/c1-4-6-7-11-18-29-19-17-26(24-13-9-8-10-14-24)25(21-29)22-31-27-16-15-23(12-5-2)20-28(27)30-3;3-1(4)2(5)6/h5,8-10,13-16,20,25-26H,2,4,6-7,11-12,17-19,21-22H2,1,3H3;(H,3,4)(H,5,6)/t25-,26-;/m1./s1 |
| InChIKey | BWPOGZBZYOZSKM-JUJAXGASSA-N |
| XLogP | 5.64 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|