C24H28F3NO2 — CID 19751316
3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidine (PubChem CID 19751316) has the molecular formula C24H28F3NO2 and a molecular weight of 419.49 g/mol. Its IUPAC name is 3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidine.
| Compound Name | 3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 19751316 |
| Molecular Formula | C24H28F3NO2 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 3-[(2-methoxy-4-prop-2-enylphenoxy)methyl]-1-methyl-4-[3-(trifluoromethyl)phenyl]piperidine |
| SMILES | C=CCc1ccc(OCC2CN(C)CCC2c2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C24H28F3NO2/c1-4-6-17-9-10-22(23(13-17)29-3)30-16-19-15-28(2)12-11-21(19)18-7-5-8-20(14-18)24(25,26)27/h4-5,7-10,13-14,19,21H,1,6,11-12,15-16H2,2-3H3 |
| InChIKey | NGEBHCDRNQAEFD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|