C18H20F3NOS — CID 23184385
1-methyl-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine (PubChem CID 23184385) has the molecular formula C18H20F3NOS and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-methyl-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine.
| Compound Name | 1-methyl-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 23184385 |
| Molecular Formula | C18H20F3NOS |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 1-methyl-4-thiophen-2-yl-3-[[3-(trifluoromethyl)phenoxy]methyl]piperidine |
| SMILES | CN1CCC(c2cccs2)C(COc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H20F3NOS/c1-22-8-7-16(17-6-3-9-24-17)13(11-22)12-23-15-5-2-4-14(10-15)18(19,20)21/h2-6,9-10,13,16H,7-8,11-12H2,1H3 |
| InChIKey | WNPMMDWAMJDGSY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |