C20H22F3NO2 — CID 78805308
N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 78805308) has the molecular formula C20H22F3NO2 and a molecular weight of 365.40 g/mol. Its IUPAC name is N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 78805308 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(3-methoxy-4-prop-2-enoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | C=CCOc1ccc(CNC(C)c2cccc(C(F)(F)F)c2)cc1OC |
| InChI | InChI=1S/C20H22F3NO2/c1-4-10-26-18-9-8-15(11-19(18)25-3)13-24-14(2)16-6-5-7-17(12-16)20(21,22)23/h4-9,11-12,14,24H,1,10,13H2,2-3H3 |
| InChIKey | CWYXVNHVTKLDDB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|