C22H33N3O2 — CID 54360896
1-[[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methyl]pyrrole-2,5-diol (PubChem CID 54360896) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methyl]pyrrole-2,5-diol.
| Compound Name | 1-[[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methyl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54360896 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 1-[[(3R,4S)-1-butyl-4-[4-(dimethylamino)phenyl]piperidin-3-yl]methyl]pyrrole-2,5-diol |
| SMILES | CCCCN1CC[C@H](c2ccc(N(C)C)cc2)[C@@H](Cn2c(O)ccc2O)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-4-5-13-24-14-12-20(17-6-8-19(9-7-17)23(2)3)18(15-24)16-25-21(26)10-11-22(25)27/h6-11,18,20,26-27H,4-5,12-16H2,1-3H3/t18-,20-/m1/s1 |
| InChIKey | UMKNUXONYBFFPF-UYAOXDASSA-N |
| XLogP | 3.87 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|