C11H15NOS — CID 140911428
(2S,3S)-2-methyl-3-phenyl-1,4,5-oxathiazepane (PubChem CID 140911428) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-phenyl-1,4,5-oxathiazepane.
| Compound Name | (2S,3S)-2-methyl-3-phenyl-1,4,5-oxathiazepane |
|---|---|
| PubChem CID | 140911428 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2S,3S)-2-methyl-3-phenyl-1,4,5-oxathiazepane |
| SMILES | C[C@@H]1OCCNS[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NOS/c1-9-11(14-12-7-8-13-9)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | XJFVYUROAHBIFD-GXSJLCMTSA-N |
| XLogP | 2.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|