C15H20N2O2S2 — CID 120919732
(2R,3S)-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylmorpholine-3-carboxamide (PubChem CID 120919732) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2R,3S)-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylmorpholine-3-carboxamide.
| Compound Name | (2R,3S)-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 120919732 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2R,3S)-N-[3-(1,3-dithiolan-2-yl)phenyl]-2-methylmorpholine-3-carboxamide |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)Nc1cccc(C2SCCS2)c1 |
| InChI | InChI=1S/C15H20N2O2S2/c1-10-13(16-5-6-19-10)14(18)17-12-4-2-3-11(9-12)15-20-7-8-21-15/h2-4,9-10,13,15-16H,5-8H2,1H3,(H,17,18)/t10-,13+/m1/s1 |
| InChIKey | SCWRXFHSHUZEDV-MFKMUULPSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |