C14H18N2O2S2 — CID 119692150
N-[3-(1,3-dithiolan-2-yl)phenyl]morpholine-2-carboxamide (PubChem CID 119692150) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[3-(1,3-dithiolan-2-yl)phenyl]morpholine-2-carboxamide.
| Compound Name | N-[3-(1,3-dithiolan-2-yl)phenyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119692150 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N-[3-(1,3-dithiolan-2-yl)phenyl]morpholine-2-carboxamide |
| SMILES | O=C(Nc1cccc(C2SCCS2)c1)C1CNCCO1 |
| InChI | InChI=1S/C14H18N2O2S2/c17-13(12-9-15-4-5-18-12)16-11-3-1-2-10(8-11)14-19-6-7-20-14/h1-3,8,12,14-15H,4-7,9H2,(H,16,17) |
| InChIKey | JGAUCKNBTDBYEZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |