About carbamic acid;3-methyl-2-phenylmorpholine
carbamic acid;3-methyl-2-phenylmorpholine (PubChem CID 22214019) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is carbamic acid;3-methyl-2-phenylmorpholine.
Molecular Properties
| Compound Name | carbamic acid;3-methyl-2-phenylmorpholine |
| PubChem CID | 22214019 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | carbamic acid;3-methyl-2-phenylmorpholine |
| SMILES | CC1NCCOC1c1ccccc1.NC(=O)O |
| InChI | InChI=1S/C11H15NO.CH3NO2/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10;2-1(3)4/h2-6,9,11-12H,7-8H2,1H3;2H2,(H,3,4) |
| InChIKey | WWVQSWXEVYZFIA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbamic acid;3-methyl-2-phenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;3-methyl-2-phenylmorpholine?
The IUPAC name of carbamic acid;3-methyl-2-phenylmorpholine (CID 22214019) is carbamic acid;3-methyl-2-phenylmorpholine.
What is the SMILES notation for carbamic acid;3-methyl-2-phenylmorpholine?
The canonical SMILES for carbamic acid;3-methyl-2-phenylmorpholine is CC1NCCOC1c1ccccc1.NC(=O)O.
What is the InChIKey of carbamic acid;3-methyl-2-phenylmorpholine?
The InChIKey is WWVQSWXEVYZFIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.CH3NO2/c1-9-11(13-8-7-12-9)10-5-3-2-4-6-10;2-1(3)4/h2-6,9,11-12H,7-8H2,1H3;2H2,(H,3,4).
What are the key properties of carbamic acid;3-methyl-2-phenylmorpholine?
carbamic acid;3-methyl-2-phenylmorpholine has a molecular weight of 238.29 g/mol, XLogP of 1.36, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;3-methyl-2-phenylmorpholine is sourced from PubChem (CID 22214019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).