C12H16ClNO — CID 43498435
2-(4-chlorophenyl)-3-methyl-1,4-oxazepane (PubChem CID 43498435) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-methyl-1,4-oxazepane.
| Compound Name | 2-(4-chlorophenyl)-3-methyl-1,4-oxazepane |
|---|---|
| PubChem CID | 43498435 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2-(4-chlorophenyl)-3-methyl-1,4-oxazepane |
| SMILES | CC1NCCCOC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H16ClNO/c1-9-12(15-8-2-7-14-9)10-3-5-11(13)6-4-10/h3-6,9,12,14H,2,7-8H2,1H3 |
| InChIKey | XRYQDKJWOWDECI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |