About ethanol;2-phenylmorpholin-3-ol
ethanol;2-phenylmorpholin-3-ol (PubChem CID 174468375) has the molecular formula C12H19NO3
and a molecular weight of 225.29 g/mol. Its IUPAC name is ethanol;2-phenylmorpholin-3-ol.
Molecular Properties
| Compound Name | ethanol;2-phenylmorpholin-3-ol |
| PubChem CID | 174468375 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | ethanol;2-phenylmorpholin-3-ol |
| SMILES | CCO.OC1NCCOC1c1ccccc1 |
| InChI | InChI=1S/C10H13NO2.C2H6O/c12-10-9(13-7-6-11-10)8-4-2-1-3-5-8;1-2-3/h1-5,9-12H,6-7H2;3H,2H2,1H3 |
| InChIKey | GDULXAJZUGBJES-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethanol;2-phenylmorpholin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;2-phenylmorpholin-3-ol?
The IUPAC name of ethanol;2-phenylmorpholin-3-ol (CID 174468375) is ethanol;2-phenylmorpholin-3-ol.
What is the SMILES notation for ethanol;2-phenylmorpholin-3-ol?
The canonical SMILES for ethanol;2-phenylmorpholin-3-ol is CCO.OC1NCCOC1c1ccccc1.
What is the InChIKey of ethanol;2-phenylmorpholin-3-ol?
The InChIKey is GDULXAJZUGBJES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C2H6O/c12-10-9(13-7-6-11-10)8-4-2-1-3-5-8;1-2-3/h1-5,9-12H,6-7H2;3H,2H2,1H3.
What are the key properties of ethanol;2-phenylmorpholin-3-ol?
ethanol;2-phenylmorpholin-3-ol has a molecular weight of 225.29 g/mol, XLogP of 0.66, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;2-phenylmorpholin-3-ol is sourced from PubChem (CID 174468375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).