C23H32IN+2 — CID 160769257
bis(4-tert-butylphenyl)iodanium;N-methylacetonitrilium (PubChem CID 160769257) has the molecular formula C23H32IN+2 and a molecular weight of 449.42 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;N-methylacetonitrilium.
| Compound Name | bis(4-tert-butylphenyl)iodanium;N-methylacetonitrilium |
|---|---|
| PubChem CID | 160769257 |
| Molecular Formula | C23H32IN+2 |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;N-methylacetonitrilium |
| SMILES | CC#[N+]C.CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H26I.C3H6N/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-3-4-2/h7-14H,1-6H3;1-2H3/q2*+1 |
| InChIKey | SDFYFOYYGJSRMT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|