C31H35IN5+ — CID 162271142
bis(4-tert-butylphenyl)iodanium;4,5-diisocyanocyclopentane-1,2,3-tricarbonitrile;methane (PubChem CID 162271142) has the molecular formula C31H35IN5+ and a molecular weight of 604.56 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)iodanium;4,5-diisocyanocyclopentane-1,2,3-tricarbonitrile;methane.
| Compound Name | bis(4-tert-butylphenyl)iodanium;4,5-diisocyanocyclopentane-1,2,3-tricarbonitrile;methane |
|---|---|
| PubChem CID | 162271142 |
| Molecular Formula | C31H35IN5+ |
| Molecular Weight | 604.56 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | bis(4-tert-butylphenyl)iodanium;4,5-diisocyanocyclopentane-1,2,3-tricarbonitrile;methane |
| SMILES | C.CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.[C-]#[N+]C1C(C#N)C(C#N)C(C#N)C1[N+]#[C-] |
| InChI | InChI=1S/C20H26I.C10H5N5.CH4/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;1-14-9-7(4-12)6(3-11)8(5-13)10(9)15-2;/h7-14H,1-6H3;6-10H;1H4/q+1;; |
| InChIKey | PGKGBMACCXHFNN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|