C18H27N3O3 — CID 95141758
(3R)-3-N-[(2-ethoxyphenyl)methyl]-3-N-ethylpiperidine-1,3-dicarboxamide (PubChem CID 95141758) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is (3R)-3-N-[(2-ethoxyphenyl)methyl]-3-N-ethylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[(2-ethoxyphenyl)methyl]-3-N-ethylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95141758 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | (3R)-3-N-[(2-ethoxyphenyl)methyl]-3-N-ethylpiperidine-1,3-dicarboxamide |
| SMILES | CCOc1ccccc1CN(CC)C(=O)[C@@H]1CCCN(C(N)=O)C1 |
| InChI | InChI=1S/C18H27N3O3/c1-3-20(12-14-8-5-6-10-16(14)24-4-2)17(22)15-9-7-11-21(13-15)18(19)23/h5-6,8,10,15H,3-4,7,9,11-13H2,1-2H3,(H2,19,23)/t15-/m1/s1 |
| InChIKey | FGHTUZDHZKQXRO-OAHLLOKOSA-N |
| XLogP | 2.22 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |