C19H23N3O5 — CID 108961363
3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(furan-2-ylmethyl)-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961363) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is 3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(furan-2-ylmethyl)-2,2-dimethyl-3-oxopropanamide.
| Compound Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(furan-2-ylmethyl)-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961363 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-N-(furan-2-ylmethyl)-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(C)(C(=O)NCc1ccco1)C(=O)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C19H23N3O5/c1-19(2,17(24)20-13-14-5-3-11-26-14)18(25)22-9-7-21(8-10-22)16(23)15-6-4-12-27-15/h3-6,11-12H,7-10,13H2,1-2H3,(H,20,24) |
| InChIKey | OJFPZRWTSGUSCF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|