C14H22N2O3 — CID 108961366
N,N-diethyl-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide (PubChem CID 108961366) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N,N-diethyl-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide.
| Compound Name | N,N-diethyl-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108961366 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N,N-diethyl-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)C(=O)C(C)(C)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H22N2O3/c1-5-16(6-2)13(18)14(3,4)12(17)15-10-11-8-7-9-19-11/h7-9H,5-6,10H2,1-4H3,(H,15,17) |
| InChIKey | DMPQFMFHQFUWMG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|