C21H29N3O3 — CID 108961481
N-[4-(diethylamino)-2-methylphenyl]-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide (PubChem CID 108961481) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108961481 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-N'-(furan-2-ylmethyl)-2,2-dimethylpropanediamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)(C)C(=O)NCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-6-24(7-2)16-10-11-18(15(3)13-16)23-20(26)21(4,5)19(25)22-14-17-9-8-12-27-17/h8-13H,6-7,14H2,1-5H3,(H,22,25)(H,23,26) |
| InChIKey | WHVSMPZLBNNWRU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|