C18H20N2O3 — CID 38911085
[4-(2,5-dimethylbenzoyl)piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 38911085) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is [4-(2,5-dimethylbenzoyl)piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-(2,5-dimethylbenzoyl)piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 38911085 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | [4-(2,5-dimethylbenzoyl)piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | Cc1ccc(C)c(C(=O)N2CCN(C(=O)c3ccco3)CC2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-13-5-6-14(2)15(12-13)17(21)19-7-9-20(10-8-19)18(22)16-4-3-11-23-16/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | XUCTWEMOELBROJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |