C16H24N2O2 — CID 764347
furan-2-yl-[4-[(1R,3R)-3-methylcyclohexyl]piperazin-1-yl]methanone (PubChem CID 764347) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is furan-2-yl-[4-[(1R,3R)-3-methylcyclohexyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(1R,3R)-3-methylcyclohexyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 764347 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | furan-2-yl-[4-[(1R,3R)-3-methylcyclohexyl]piperazin-1-yl]methanone |
| SMILES | C[C@@H]1CCC[C@@H](N2CCN(C(=O)c3ccco3)CC2)C1 |
| InChI | InChI=1S/C16H24N2O2/c1-13-4-2-5-14(12-13)17-7-9-18(10-8-17)16(19)15-6-3-11-20-15/h3,6,11,13-14H,2,4-5,7-10,12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | VIVZJZMYIFYJPB-ZIAGYGMSSA-N |
| XLogP | 2.62 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |