C14H18N2O4 — CID 47131799
3-[4-(furan-2-carbonyl)piperazin-1-yl]-5-methyloxolan-2-one (PubChem CID 47131799) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 3-[4-(furan-2-carbonyl)piperazin-1-yl]-5-methyloxolan-2-one.
| Compound Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 47131799 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 3-[4-(furan-2-carbonyl)piperazin-1-yl]-5-methyloxolan-2-one |
| SMILES | CC1CC(N2CCN(C(=O)c3ccco3)CC2)C(=O)O1 |
| InChI | InChI=1S/C14H18N2O4/c1-10-9-11(14(18)20-10)15-4-6-16(7-5-15)13(17)12-3-2-8-19-12/h2-3,8,10-11H,4-7,9H2,1H3 |
| InChIKey | OXMONZRJBLKCCO-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |