C16H24N4O2 — CID 111167061
N'-ethyl-4-(furan-2-carbonyl)-N-(2-methylcyclopropyl)piperazine-1-carboximidamide (PubChem CID 111167061) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-ethyl-4-(furan-2-carbonyl)-N-(2-methylcyclopropyl)piperazine-1-carboximidamide.
| Compound Name | N'-ethyl-4-(furan-2-carbonyl)-N-(2-methylcyclopropyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167061 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | N'-ethyl-4-(furan-2-carbonyl)-N-(2-methylcyclopropyl)piperazine-1-carboximidamide |
| SMILES | CC/N=C(/NC1CC1C)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C16H24N4O2/c1-3-17-16(18-13-11-12(13)2)20-8-6-19(7-9-20)15(21)14-5-4-10-22-14/h4-5,10,12-13H,3,6-9,11H2,1-2H3,(H,17,18) |
| InChIKey | VYVFBGSYNHQSTH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|