C28H39N3O5 — CID 42383240
1-[2-[(3R)-1-cyclopentyl-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]-N,N-diethylpiperidine-4-carboxamide (PubChem CID 42383240) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-[2-[(3R)-1-cyclopentyl-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]-N,N-diethylpiperidine-4-carboxamide.
| Compound Name | 1-[2-[(3R)-1-cyclopentyl-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]-N,N-diethylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 42383240 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | 1-[2-[(3R)-1-cyclopentyl-3-(3-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]-N,N-diethylpiperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(C(=O)C[C@]2(c3cccc(OC)c3)CC(=O)N(C3CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C28H39N3O5/c1-4-29(5-2)26(34)20-13-15-30(16-14-20)24(32)18-28(21-9-8-12-23(17-21)36-3)19-25(33)31(27(28)35)22-10-6-7-11-22/h8-9,12,17,20,22H,4-7,10-11,13-16,18-19H2,1-3H3/t28-/m1/s1 |
| InChIKey | RCVMKYVNWUXUAZ-MUUNZHRXSA-N |
| XLogP | 3.13 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|