C29H35N3O4 — CID 45202246
N,N-diethyl-1-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]piperidine-4-carboxamide (PubChem CID 45202246) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is N,N-diethyl-1-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]piperidine-4-carboxamide.
| Compound Name | N,N-diethyl-1-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45202246 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | N,N-diethyl-1-[2-[1-methyl-2,5-dioxo-3-(4-phenylphenyl)pyrrolidin-3-yl]acetyl]piperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(C(=O)CC2(c3ccc(-c4ccccc4)cc3)CC(=O)N(C)C2=O)CC1 |
| InChI | InChI=1S/C29H35N3O4/c1-4-31(5-2)27(35)23-15-17-32(18-16-23)26(34)20-29(19-25(33)30(3)28(29)36)24-13-11-22(12-14-24)21-9-7-6-8-10-21/h6-14,23H,4-5,15-20H2,1-3H3 |
| InChIKey | VPARRBFENDWBIG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|