C24H29FN2O5 — CID 45177865
methyl 1-[2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-4-carboxylate (PubChem CID 45177865) has the molecular formula C24H29FN2O5 and a molecular weight of 444.50 g/mol. Its IUPAC name is methyl 1-[2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 45177865 |
| Molecular Formula | C24H29FN2O5 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl 1-[2-[1-cyclopentyl-3-(3-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CC2(c3cccc(F)c3)CC(=O)N(C3CCCC3)C2=O)CC1 |
| InChI | InChI=1S/C24H29FN2O5/c1-32-22(30)16-9-11-26(12-10-16)20(28)14-24(17-5-4-6-18(25)13-17)15-21(29)27(23(24)31)19-7-2-3-8-19/h4-6,13,16,19H,2-3,7-12,14-15H2,1H3 |
| InChIKey | HAFOYPLUNXGHSJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|