C26H28ClFN4O3 — CID 45171591
3-[2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione (PubChem CID 45171591) has the molecular formula C26H28ClFN4O3 and a molecular weight of 498.99 g/mol. Its IUPAC name is 3-[2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione.
| Compound Name | 3-[2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 45171591 |
| Molecular Formula | C26H28ClFN4O3 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | 3-[2-[4-(5-chloro-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]-1-cyclopentyl-3-(3-fluorophenyl)pyrrolidine-2,5-dione |
| SMILES | O=C(CC1(c2cccc(F)c2)CC(=O)N(C2CCCC2)C1=O)N1CCN(c2ccc(Cl)cn2)CC1 |
| InChI | InChI=1S/C26H28ClFN4O3/c27-19-8-9-22(29-17-19)30-10-12-31(13-11-30)23(33)15-26(18-4-3-5-20(28)14-18)16-24(34)32(25(26)35)21-6-1-2-7-21/h3-5,8-9,14,17,21H,1-2,6-7,10-13,15-16H2 |
| InChIKey | FUWXXBXSFJQWHQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|