C27H30ClN3O3 — CID 42169235
(3R)-3-(2-chlorophenyl)-1-cyclopentyl-3-[2-oxo-2-(4-pyridin-4-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione (PubChem CID 42169235) has the molecular formula C27H30ClN3O3 and a molecular weight of 480.01 g/mol. Its IUPAC name is (3R)-3-(2-chlorophenyl)-1-cyclopentyl-3-[2-oxo-2-(4-pyridin-4-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(2-chlorophenyl)-1-cyclopentyl-3-[2-oxo-2-(4-pyridin-4-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42169235 |
| Molecular Formula | C27H30ClN3O3 |
| Molecular Weight | 480.01 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (3R)-3-(2-chlorophenyl)-1-cyclopentyl-3-[2-oxo-2-(4-pyridin-4-ylpiperidin-1-yl)ethyl]pyrrolidine-2,5-dione |
| SMILES | O=C(C[C@]1(c2ccccc2Cl)CC(=O)N(C2CCCC2)C1=O)N1CCC(c2ccncc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O3/c28-23-8-4-3-7-22(23)27(18-25(33)31(26(27)34)21-5-1-2-6-21)17-24(32)30-15-11-20(12-16-30)19-9-13-29-14-10-19/h3-4,7-10,13-14,20-21H,1-2,5-6,11-12,15-18H2/t27-/m1/s1 |
| InChIKey | QSAPJIZXDCOUCV-HHHXNRCGSA-N |
| XLogP | 4.47 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.01 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|