C23H25ClN2O4 — CID 118756108
2-[3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-N-methylacetamide (PubChem CID 118756108) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is 2-[3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-N-methylacetamide.
| Compound Name | 2-[3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 118756108 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[3-(2-chlorophenyl)-1-cyclopentyl-2,5-dioxopyrrolidin-3-yl]-N-(furan-2-ylmethyl)-N-methylacetamide |
| SMILES | CN(Cc1ccco1)C(=O)CC1(c2ccccc2Cl)CC(=O)N(C2CCCC2)C1=O |
| InChI | InChI=1S/C23H25ClN2O4/c1-25(15-17-9-6-12-30-17)20(27)13-23(18-10-4-5-11-19(18)24)14-21(28)26(22(23)29)16-7-2-3-8-16/h4-6,9-12,16H,2-3,7-8,13-15H2,1H3 |
| InChIKey | BFNCUOAHJOAVGT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|